C14H18FN — CID 167026383
(2S)-5-cyclopropyl-2-[(3Z,5E)-5-fluorohepta-1,3,5-trien-2-yl]-3,4-dihydro-2H-pyrrole (PubChem CID 167026383) has the molecular formula C14H18FN and a molecular weight of 219.30 g/mol. Its IUPAC name is (2S)-5-cyclopropyl-2-[(3Z,5E)-5-fluorohepta-1,3,5-trien-2-yl]-3,4-dihydro-2H-pyrrole.
| Compound Name | (2S)-5-cyclopropyl-2-[(3Z,5E)-5-fluorohepta-1,3,5-trien-2-yl]-3,4-dihydro-2H-pyrrole |
|---|---|
| PubChem CID | 167026383 |
| Molecular Formula | C14H18FN |
| Molecular Weight | 219.30 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | (2S)-5-cyclopropyl-2-[(3Z,5E)-5-fluorohepta-1,3,5-trien-2-yl]-3,4-dihydro-2H-pyrrole |
| SMILES | C=C(/C=C\C(F)=C/C)[C@@H]1CCC(C2CC2)=N1 |
| InChI | InChI=1S/C14H18FN/c1-3-12(15)7-4-10(2)13-8-9-14(16-13)11-5-6-11/h3-4,7,11,13H,2,5-6,8-9H2,1H3/b7-4-,12-3+/t13-/m0/s1 |
| InChIKey | UMIRXZNYTZRCCJ-GMLPYRPUSA-N |
| XLogP | 3.99 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.30 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|