About [(1S)-3,3-difluorocyclohexyl]-(4-propan-2-ylpiperazin-1-yl)methanone
[(1S)-3,3-difluorocyclohexyl]-(4-propan-2-ylpiperazin-1-yl)methanone (PubChem CID 167026512) has the molecular formula C14H24F2N2O
and a molecular weight of 274.35 g/mol. Its IUPAC name is [(1S)-3,3-difluorocyclohexyl]-(4-propan-2-ylpiperazin-1-yl)methanone.
Molecular Properties
| Compound Name | [(1S)-3,3-difluorocyclohexyl]-(4-propan-2-ylpiperazin-1-yl)methanone |
| PubChem CID | 167026512 |
| Molecular Formula | C14H24F2N2O |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | [(1S)-3,3-difluorocyclohexyl]-(4-propan-2-ylpiperazin-1-yl)methanone |
| SMILES | CC(C)N1CCN(C(=O)[C@H]2CCCC(F)(F)C2)CC1 |
| InChI | InChI=1S/C14H24F2N2O/c1-11(2)17-6-8-18(9-7-17)13(19)12-4-3-5-14(15,16)10-12/h11-12H,3-10H2,1-2H3/t12-/m0/s1 |
| InChIKey | XAFBPHVJGOSHFJ-LBPRGKRZSA-N |
| XLogP | 2.36 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(1S)-3,3-difluorocyclohexyl]-(4-propan-2-ylpiperazin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-3,3-difluorocyclohexyl]-(4-propan-2-ylpiperazin-1-yl)methanone?
The IUPAC name of [(1S)-3,3-difluorocyclohexyl]-(4-propan-2-ylpiperazin-1-yl)methanone (CID 167026512) is [(1S)-3,3-difluorocyclohexyl]-(4-propan-2-ylpiperazin-1-yl)methanone.
What is the SMILES notation for [(1S)-3,3-difluorocyclohexyl]-(4-propan-2-ylpiperazin-1-yl)methanone?
The canonical SMILES for [(1S)-3,3-difluorocyclohexyl]-(4-propan-2-ylpiperazin-1-yl)methanone is CC(C)N1CCN(C(=O)[C@H]2CCCC(F)(F)C2)CC1.
What is the InChIKey of [(1S)-3,3-difluorocyclohexyl]-(4-propan-2-ylpiperazin-1-yl)methanone?
The InChIKey is XAFBPHVJGOSHFJ-LBPRGKRZSA-N. The full InChI is InChI=1S/C14H24F2N2O/c1-11(2)17-6-8-18(9-7-17)13(19)12-4-3-5-14(15,16)10-12/h11-12H,3-10H2,1-2H3/t12-/m0/s1.
What are the key properties of [(1S)-3,3-difluorocyclohexyl]-(4-propan-2-ylpiperazin-1-yl)methanone?
[(1S)-3,3-difluorocyclohexyl]-(4-propan-2-ylpiperazin-1-yl)methanone has a molecular weight of 274.35 g/mol, XLogP of 2.36, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-3,3-difluorocyclohexyl]-(4-propan-2-ylpiperazin-1-yl)methanone is sourced from PubChem (CID 167026512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).