C28H20F2N2O6S2 — CID 167027484
4-[1-(3,5-difluoro-4-hydroxyphenyl)-4-[4-(morpholine-4-carbonyl)phenyl]sulfanyl-2,5-dioxopyrrol-3-yl]sulfanylbenzaldehyde (PubChem CID 167027484) has the molecular formula C28H20F2N2O6S2 and a molecular weight of 582.61 g/mol. Its IUPAC name is 4-[1-(3,5-difluoro-4-hydroxyphenyl)-4-[4-(morpholine-4-carbonyl)phenyl]sulfanyl-2,5-dioxopyrrol-3-yl]sulfanylbenzaldehyde.
| Compound Name | 4-[1-(3,5-difluoro-4-hydroxyphenyl)-4-[4-(morpholine-4-carbonyl)phenyl]sulfanyl-2,5-dioxopyrrol-3-yl]sulfanylbenzaldehyde |
|---|---|
| PubChem CID | 167027484 |
| Molecular Formula | C28H20F2N2O6S2 |
| Molecular Weight | 582.61 g/mol |
| Exact Mass | 582.07 |
| IUPAC Name | 4-[1-(3,5-difluoro-4-hydroxyphenyl)-4-[4-(morpholine-4-carbonyl)phenyl]sulfanyl-2,5-dioxopyrrol-3-yl]sulfanylbenzaldehyde |
| SMILES | O=Cc1ccc(SC2=C(Sc3ccc(C(=O)N4CCOCC4)cc3)C(=O)N(c3cc(F)c(O)c(F)c3)C2=O)cc1 |
| InChI | InChI=1S/C28H20F2N2O6S2/c29-21-13-18(14-22(30)23(21)34)32-27(36)24(39-19-5-1-16(15-33)2-6-19)25(28(32)37)40-20-7-3-17(4-8-20)26(35)31-9-11-38-12-10-31/h1-8,13-15,34H,9-12H2 |
| InChIKey | CRDIEUGZRLKPHW-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.61 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|