About [2-[(1Z)-buta-1,3-dienyl]-5-ethenyl-3-methyl-4-[(Z)-prop-1-enyl]pyrrol-1-yl]-phosphanylphosphane
[2-[(1Z)-buta-1,3-dienyl]-5-ethenyl-3-methyl-4-[(Z)-prop-1-enyl]pyrrol-1-yl]-phosphanylphosphane (PubChem CID 167027514) has the molecular formula C14H19NP2
and a molecular weight of 263.26 g/mol. Its IUPAC name is [2-[(1Z)-buta-1,3-dienyl]-5-ethenyl-3-methyl-4-[(Z)-prop-1-enyl]pyrrol-1-yl]-phosphanylphosphane.
Molecular Properties
| Compound Name | [2-[(1Z)-buta-1,3-dienyl]-5-ethenyl-3-methyl-4-[(Z)-prop-1-enyl]pyrrol-1-yl]-phosphanylphosphane |
| PubChem CID | 167027514 |
| Molecular Formula | C14H19NP2 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | [2-[(1Z)-buta-1,3-dienyl]-5-ethenyl-3-methyl-4-[(Z)-prop-1-enyl]pyrrol-1-yl]-phosphanylphosphane |
| SMILES | C=C/C=C\c1c(C)c(/C=C\C)c(C=C)n1PP |
| InChI | InChI=1S/C14H19NP2/c1-5-8-10-14-11(4)12(9-6-2)13(7-3)15(14)17-16/h5-10,17H,1,3,16H2,2,4H3/b9-6-,10-8- |
| InChIKey | ZGIUVKXUKYSQBU-PTKGMRGESA-N |
| XLogP | 4.90 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [2-[(1Z)-buta-1,3-dienyl]-5-ethenyl-3-methyl-4-[(Z)-prop-1-enyl]pyrrol-1-yl]-phosphanylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(1Z)-buta-1,3-dienyl]-5-ethenyl-3-methyl-4-[(Z)-prop-1-enyl]pyrrol-1-yl]-phosphanylphosphane?
The IUPAC name of [2-[(1Z)-buta-1,3-dienyl]-5-ethenyl-3-methyl-4-[(Z)-prop-1-enyl]pyrrol-1-yl]-phosphanylphosphane (CID 167027514) is [2-[(1Z)-buta-1,3-dienyl]-5-ethenyl-3-methyl-4-[(Z)-prop-1-enyl]pyrrol-1-yl]-phosphanylphosphane.
What is the SMILES notation for [2-[(1Z)-buta-1,3-dienyl]-5-ethenyl-3-methyl-4-[(Z)-prop-1-enyl]pyrrol-1-yl]-phosphanylphosphane?
The canonical SMILES for [2-[(1Z)-buta-1,3-dienyl]-5-ethenyl-3-methyl-4-[(Z)-prop-1-enyl]pyrrol-1-yl]-phosphanylphosphane is C=C/C=C\c1c(C)c(/C=C\C)c(C=C)n1PP.
What is the InChIKey of [2-[(1Z)-buta-1,3-dienyl]-5-ethenyl-3-methyl-4-[(Z)-prop-1-enyl]pyrrol-1-yl]-phosphanylphosphane?
The InChIKey is ZGIUVKXUKYSQBU-PTKGMRGESA-N. The full InChI is InChI=1S/C14H19NP2/c1-5-8-10-14-11(4)12(9-6-2)13(7-3)15(14)17-16/h5-10,17H,1,3,16H2,2,4H3/b9-6-,10-8-.
What are the key properties of [2-[(1Z)-buta-1,3-dienyl]-5-ethenyl-3-methyl-4-[(Z)-prop-1-enyl]pyrrol-1-yl]-phosphanylphosphane?
[2-[(1Z)-buta-1,3-dienyl]-5-ethenyl-3-methyl-4-[(Z)-prop-1-enyl]pyrrol-1-yl]-phosphanylphosphane has a molecular weight of 263.26 g/mol, XLogP of 4.90, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(1Z)-buta-1,3-dienyl]-5-ethenyl-3-methyl-4-[(Z)-prop-1-enyl]pyrrol-1-yl]-phosphanylphosphane is sourced from PubChem (CID 167027514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).