C33H28F3N3O7S2 — CID 167027535
1-[4-hydroxy-3-(trifluoromethyl)phenyl]-3,4-bis[[4-(morpholine-4-carbonyl)phenyl]sulfanyl]pyrrole-2,5-dione (PubChem CID 167027535) has the molecular formula C33H28F3N3O7S2 and a molecular weight of 699.73 g/mol. Its IUPAC name is 1-[4-hydroxy-3-(trifluoromethyl)phenyl]-3,4-bis[[4-(morpholine-4-carbonyl)phenyl]sulfanyl]pyrrole-2,5-dione.
| Compound Name | 1-[4-hydroxy-3-(trifluoromethyl)phenyl]-3,4-bis[[4-(morpholine-4-carbonyl)phenyl]sulfanyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 167027535 |
| Molecular Formula | C33H28F3N3O7S2 |
| Molecular Weight | 699.73 g/mol |
| Exact Mass | 699.13 |
| IUPAC Name | 1-[4-hydroxy-3-(trifluoromethyl)phenyl]-3,4-bis[[4-(morpholine-4-carbonyl)phenyl]sulfanyl]pyrrole-2,5-dione |
| SMILES | O=C(c1ccc(SC2=C(Sc3ccc(C(=O)N4CCOCC4)cc3)C(=O)N(c3ccc(O)c(C(F)(F)F)c3)C2=O)cc1)N1CCOCC1 |
| InChI | InChI=1S/C33H28F3N3O7S2/c34-33(35,36)25-19-22(5-10-26(25)40)39-31(43)27(47-23-6-1-20(2-7-23)29(41)37-11-15-45-16-12-37)28(32(39)44)48-24-8-3-21(4-9-24)30(42)38-13-17-46-18-14-38/h1-10,19,40H,11-18H2 |
| InChIKey | GXFGUEXNVCTOLN-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 116.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.73 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|