About 11-chloro-10-ethoxy-6,11-dihydrobenzo[c][1]benzothiepine
11-chloro-10-ethoxy-6,11-dihydrobenzo[c][1]benzothiepine (PubChem CID 167028027) has the molecular formula C16H15ClOS
and a molecular weight of 290.82 g/mol. Its IUPAC name is 11-chloro-10-ethoxy-6,11-dihydrobenzo[c][1]benzothiepine.
Molecular Properties
| Compound Name | 11-chloro-10-ethoxy-6,11-dihydrobenzo[c][1]benzothiepine |
| PubChem CID | 167028027 |
| Molecular Formula | C16H15ClOS |
| Molecular Weight | 290.82 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 11-chloro-10-ethoxy-6,11-dihydrobenzo[c][1]benzothiepine |
| SMILES | CCOc1cccc2c1C(Cl)c1ccccc1SC2 |
| InChI | InChI=1S/C16H15ClOS/c1-2-18-13-8-5-6-11-10-19-14-9-4-3-7-12(14)16(17)15(11)13/h3-9,16H,2,10H2,1H3 |
| InChIKey | GNGSOLFVEJYBJP-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 290.82 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 11-chloro-10-ethoxy-6,11-dihydrobenzo[c][1]benzothiepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-chloro-10-ethoxy-6,11-dihydrobenzo[c][1]benzothiepine?
The IUPAC name of 11-chloro-10-ethoxy-6,11-dihydrobenzo[c][1]benzothiepine (CID 167028027) is 11-chloro-10-ethoxy-6,11-dihydrobenzo[c][1]benzothiepine.
What is the SMILES notation for 11-chloro-10-ethoxy-6,11-dihydrobenzo[c][1]benzothiepine?
The canonical SMILES for 11-chloro-10-ethoxy-6,11-dihydrobenzo[c][1]benzothiepine is CCOc1cccc2c1C(Cl)c1ccccc1SC2.
What is the InChIKey of 11-chloro-10-ethoxy-6,11-dihydrobenzo[c][1]benzothiepine?
The InChIKey is GNGSOLFVEJYBJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15ClOS/c1-2-18-13-8-5-6-11-10-19-14-9-4-3-7-12(14)16(17)15(11)13/h3-9,16H,2,10H2,1H3.
What are the key properties of 11-chloro-10-ethoxy-6,11-dihydrobenzo[c][1]benzothiepine?
11-chloro-10-ethoxy-6,11-dihydrobenzo[c][1]benzothiepine has a molecular weight of 290.82 g/mol, XLogP of 5.02, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 11-chloro-10-ethoxy-6,11-dihydrobenzo[c][1]benzothiepine is sourced from PubChem (CID 167028027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).