C31H41NO2 — CID 167028383
5-[(Z)-2-cyclohexa-1,5-dien-1-yl-1-[4-(1-ethylpiperidin-4-yl)cyclohexa-1,3-dien-1-yl]-5-hydroxypent-1-enyl]cyclohepta-1,3,6-trien-1-ol (PubChem CID 167028383) has the molecular formula C31H41NO2 and a molecular weight of 459.67 g/mol. Its IUPAC name is 5-[(Z)-2-cyclohexa-1,5-dien-1-yl-1-[4-(1-ethylpiperidin-4-yl)cyclohexa-1,3-dien-1-yl]-5-hydroxypent-1-enyl]cyclohepta-1,3,6-trien-1-ol.
| Compound Name | 5-[(Z)-2-cyclohexa-1,5-dien-1-yl-1-[4-(1-ethylpiperidin-4-yl)cyclohexa-1,3-dien-1-yl]-5-hydroxypent-1-enyl]cyclohepta-1,3,6-trien-1-ol |
|---|---|
| PubChem CID | 167028383 |
| Molecular Formula | C31H41NO2 |
| Molecular Weight | 459.67 g/mol |
| Exact Mass | 459.31 |
| IUPAC Name | 5-[(Z)-2-cyclohexa-1,5-dien-1-yl-1-[4-(1-ethylpiperidin-4-yl)cyclohexa-1,3-dien-1-yl]-5-hydroxypent-1-enyl]cyclohepta-1,3,6-trien-1-ol |
| SMILES | CCN1CCC(C2=CC=C(/C(=C(/CCCO)C3=CCCC=C3)C3C=CC=C(O)C=C3)CC2)CC1 |
| InChI | InChI=1S/C31H41NO2/c1-2-32-21-19-25(20-22-32)24-13-15-28(16-14-24)31(27-10-6-11-29(34)18-17-27)30(12-7-23-33)26-8-4-3-5-9-26/h4,6,8-11,13,15,17-18,25,27,33-34H,2-3,5,7,12,14,16,19-23H2,1H3/b31-30- |
| InChIKey | ZLXVHTXEWMHTBQ-KTMFPKCZSA-N |
| XLogP | 6.89 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.67 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |