C27H31NO2 — CID 167028428
(4Z,7Z,9E)-5-[4-(azetidin-3-yl)phenyl]-6-methylidene-4-phenylundeca-4,7,9-triene-1,9-diol (PubChem CID 167028428) has the molecular formula C27H31NO2 and a molecular weight of 401.55 g/mol. Its IUPAC name is (4Z,7Z,9E)-5-[4-(azetidin-3-yl)phenyl]-6-methylidene-4-phenylundeca-4,7,9-triene-1,9-diol.
| Compound Name | (4Z,7Z,9E)-5-[4-(azetidin-3-yl)phenyl]-6-methylidene-4-phenylundeca-4,7,9-triene-1,9-diol |
|---|---|
| PubChem CID | 167028428 |
| Molecular Formula | C27H31NO2 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | (4Z,7Z,9E)-5-[4-(azetidin-3-yl)phenyl]-6-methylidene-4-phenylundeca-4,7,9-triene-1,9-diol |
| SMILES | C=C(/C=C\C(O)=C/C)/C(=C(\CCCO)c1ccccc1)c1ccc(C2CNC2)cc1 |
| InChI | InChI=1S/C27H31NO2/c1-3-25(30)16-11-20(2)27(23-14-12-21(13-15-23)24-18-28-19-24)26(10-7-17-29)22-8-5-4-6-9-22/h3-6,8-9,11-16,24,28-30H,2,7,10,17-19H2,1H3/b16-11-,25-3+,27-26- |
| InChIKey | MESYNCJYQDDSCL-PSAWMHHWSA-N |
| XLogP | 5.63 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|