C25H19N3 — CID 167029866
4-naphthalen-2-yl-2-(4-phenylphenyl)-1,4-dihydro-1,3,5-triazine (PubChem CID 167029866) has the molecular formula C25H19N3 and a molecular weight of 361.45 g/mol. Its IUPAC name is 4-naphthalen-2-yl-2-(4-phenylphenyl)-1,4-dihydro-1,3,5-triazine.
| Compound Name | 4-naphthalen-2-yl-2-(4-phenylphenyl)-1,4-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 167029866 |
| Molecular Formula | C25H19N3 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 4-naphthalen-2-yl-2-(4-phenylphenyl)-1,4-dihydro-1,3,5-triazine |
| SMILES | C1=NC(c2ccc3ccccc3c2)N=C(c2ccc(-c3ccccc3)cc2)N1 |
| InChI | InChI=1S/C25H19N3/c1-2-6-18(7-3-1)20-10-13-21(14-11-20)24-26-17-27-25(28-24)23-15-12-19-8-4-5-9-22(19)16-23/h1-17,25H,(H,26,27,28) |
| InChIKey | KXRDVSONPJEEQK-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |