C13H11F5 — CID 167031298
(3S)-1,1,2,2,5-pentafluoro-3-methyl-3-prop-2-enylindene (PubChem CID 167031298) has the molecular formula C13H11F5 and a molecular weight of 262.22 g/mol. Its IUPAC name is (3S)-1,1,2,2,5-pentafluoro-3-methyl-3-prop-2-enylindene.
| Compound Name | (3S)-1,1,2,2,5-pentafluoro-3-methyl-3-prop-2-enylindene |
|---|---|
| PubChem CID | 167031298 |
| Molecular Formula | C13H11F5 |
| Molecular Weight | 262.22 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | (3S)-1,1,2,2,5-pentafluoro-3-methyl-3-prop-2-enylindene |
| SMILES | C=CC[C@@]1(C)c2cc(F)ccc2C(F)(F)C1(F)F |
| InChI | InChI=1S/C13H11F5/c1-3-6-11(2)10-7-8(14)4-5-9(10)12(15,16)13(11,17)18/h3-5,7H,1,6H2,2H3/t11-/m0/s1 |
| InChIKey | SMQAXZQZXHLXRI-NSHDSACASA-N |
| XLogP | 4.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.22 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|