About N-methyl-3-(5-methyl-1,3,4-oxadiazol-2-yl)-2-methylsulfanylaniline
N-methyl-3-(5-methyl-1,3,4-oxadiazol-2-yl)-2-methylsulfanylaniline (PubChem CID 167031329) has the molecular formula C11H13N3OS
and a molecular weight of 235.31 g/mol. Its IUPAC name is N-methyl-3-(5-methyl-1,3,4-oxadiazol-2-yl)-2-methylsulfanylaniline.
Molecular Properties
| Compound Name | N-methyl-3-(5-methyl-1,3,4-oxadiazol-2-yl)-2-methylsulfanylaniline |
| PubChem CID | 167031329 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | N-methyl-3-(5-methyl-1,3,4-oxadiazol-2-yl)-2-methylsulfanylaniline |
| SMILES | CNc1cccc(-c2nnc(C)o2)c1SC |
| InChI | InChI=1S/C11H13N3OS/c1-7-13-14-11(15-7)8-5-4-6-9(12-2)10(8)16-3/h4-6,12H,1-3H3 |
| InChIKey | NYOGHIAVVYKNAQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-methyl-3-(5-methyl-1,3,4-oxadiazol-2-yl)-2-methylsulfanylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-3-(5-methyl-1,3,4-oxadiazol-2-yl)-2-methylsulfanylaniline?
The IUPAC name of N-methyl-3-(5-methyl-1,3,4-oxadiazol-2-yl)-2-methylsulfanylaniline (CID 167031329) is N-methyl-3-(5-methyl-1,3,4-oxadiazol-2-yl)-2-methylsulfanylaniline.
What is the SMILES notation for N-methyl-3-(5-methyl-1,3,4-oxadiazol-2-yl)-2-methylsulfanylaniline?
The canonical SMILES for N-methyl-3-(5-methyl-1,3,4-oxadiazol-2-yl)-2-methylsulfanylaniline is CNc1cccc(-c2nnc(C)o2)c1SC.
What is the InChIKey of N-methyl-3-(5-methyl-1,3,4-oxadiazol-2-yl)-2-methylsulfanylaniline?
The InChIKey is NYOGHIAVVYKNAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3OS/c1-7-13-14-11(15-7)8-5-4-6-9(12-2)10(8)16-3/h4-6,12H,1-3H3.
What are the key properties of N-methyl-3-(5-methyl-1,3,4-oxadiazol-2-yl)-2-methylsulfanylaniline?
N-methyl-3-(5-methyl-1,3,4-oxadiazol-2-yl)-2-methylsulfanylaniline has a molecular weight of 235.31 g/mol, XLogP of 2.81, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-3-(5-methyl-1,3,4-oxadiazol-2-yl)-2-methylsulfanylaniline is sourced from PubChem (CID 167031329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).