C11H4F6O5 — CID 167031864
2,2,3,3,4,4-hexafluoro-5-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yloxy)-5-oxopentanoic acid (PubChem CID 167031864) has the molecular formula C11H4F6O5 and a molecular weight of 330.14 g/mol. Its IUPAC name is 2,2,3,3,4,4-hexafluoro-5-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yloxy)-5-oxopentanoic acid.
| Compound Name | 2,2,3,3,4,4-hexafluoro-5-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yloxy)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 167031864 |
| Molecular Formula | C11H4F6O5 |
| Molecular Weight | 330.14 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | 2,2,3,3,4,4-hexafluoro-5-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yloxy)-5-oxopentanoic acid |
| SMILES | O=C(O)C(F)(F)C(F)(F)C(F)(F)C(=O)Oc1cc2ccc1o2 |
| InChI | InChI=1S/C11H4F6O5/c12-9(13,7(18)19)11(16,17)10(14,15)8(20)22-6-3-4-1-2-5(6)21-4/h1-3H,(H,18,19) |
| InChIKey | RJWPQVCXZPQKDN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.14 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|