C19H32O2 — CID 167032941
(Z)-1,7-dicyclopentyl-5-hydroxy-2,6-dimethylhept-4-en-3-one (PubChem CID 167032941) has the molecular formula C19H32O2 and a molecular weight of 292.46 g/mol. Its IUPAC name is (Z)-1,7-dicyclopentyl-5-hydroxy-2,6-dimethylhept-4-en-3-one.
| Compound Name | (Z)-1,7-dicyclopentyl-5-hydroxy-2,6-dimethylhept-4-en-3-one |
|---|---|
| PubChem CID | 167032941 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | (Z)-1,7-dicyclopentyl-5-hydroxy-2,6-dimethylhept-4-en-3-one |
| SMILES | CC(CC1CCCC1)C(=O)/C=C(\O)C(C)CC1CCCC1 |
| InChI | InChI=1S/C19H32O2/c1-14(11-16-7-3-4-8-16)18(20)13-19(21)15(2)12-17-9-5-6-10-17/h13-17,20H,3-12H2,1-2H3/b18-13- |
| InChIKey | MZTDUSMVPPDWEL-AQTBWJFISA-N |
| XLogP | 5.43 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|