C12H19NO — CID 167032971
(2E,4Z)-N-cyclopropyl-2,5-dimethylhepta-2,4-dienamide (PubChem CID 167032971) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is (2E,4Z)-N-cyclopropyl-2,5-dimethylhepta-2,4-dienamide.
| Compound Name | (2E,4Z)-N-cyclopropyl-2,5-dimethylhepta-2,4-dienamide |
|---|---|
| PubChem CID | 167032971 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | (2E,4Z)-N-cyclopropyl-2,5-dimethylhepta-2,4-dienamide |
| SMILES | CC/C(C)=C\C=C(/C)C(=O)NC1CC1 |
| InChI | InChI=1S/C12H19NO/c1-4-9(2)5-6-10(3)12(14)13-11-7-8-11/h5-6,11H,4,7-8H2,1-3H3,(H,13,14)/b9-5-,10-6+ |
| InChIKey | COXMJBITNRDMRD-VTBWALSUSA-N |
| XLogP | 2.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|