About 4-(4-fluorophenyl)-1,2,5,6-tetrahydropyrimidine
4-(4-fluorophenyl)-1,2,5,6-tetrahydropyrimidine (PubChem CID 167033055) has the molecular formula C10H11FN2
and a molecular weight of 178.21 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-1,2,5,6-tetrahydropyrimidine.
Molecular Properties
| Compound Name | 4-(4-fluorophenyl)-1,2,5,6-tetrahydropyrimidine |
| PubChem CID | 167033055 |
| Molecular Formula | C10H11FN2 |
| Molecular Weight | 178.21 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | 4-(4-fluorophenyl)-1,2,5,6-tetrahydropyrimidine |
| SMILES | Fc1ccc(C2=NCNCC2)cc1 |
| InChI | InChI=1S/C10H11FN2/c11-9-3-1-8(2-4-9)10-5-6-12-7-13-10/h1-4,12H,5-7H2 |
| InChIKey | BWJAHSDWPBBUKI-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.21 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(4-fluorophenyl)-1,2,5,6-tetrahydropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-fluorophenyl)-1,2,5,6-tetrahydropyrimidine?
The IUPAC name of 4-(4-fluorophenyl)-1,2,5,6-tetrahydropyrimidine (CID 167033055) is 4-(4-fluorophenyl)-1,2,5,6-tetrahydropyrimidine.
What is the SMILES notation for 4-(4-fluorophenyl)-1,2,5,6-tetrahydropyrimidine?
The canonical SMILES for 4-(4-fluorophenyl)-1,2,5,6-tetrahydropyrimidine is Fc1ccc(C2=NCNCC2)cc1.
What is the InChIKey of 4-(4-fluorophenyl)-1,2,5,6-tetrahydropyrimidine?
The InChIKey is BWJAHSDWPBBUKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11FN2/c11-9-3-1-8(2-4-9)10-5-6-12-7-13-10/h1-4,12H,5-7H2.
What are the key properties of 4-(4-fluorophenyl)-1,2,5,6-tetrahydropyrimidine?
4-(4-fluorophenyl)-1,2,5,6-tetrahydropyrimidine has a molecular weight of 178.21 g/mol, XLogP of 1.57, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-fluorophenyl)-1,2,5,6-tetrahydropyrimidine is sourced from PubChem (CID 167033055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).