C12H20N2O2S — CID 167033104
(3E,5Z)-2-[(2S)-piperidin-2-yl]hepta-1,3,5-triene-4-sulfonamide (PubChem CID 167033104) has the molecular formula C12H20N2O2S and a molecular weight of 256.37 g/mol. Its IUPAC name is (3E,5Z)-2-[(2S)-piperidin-2-yl]hepta-1,3,5-triene-4-sulfonamide.
| Compound Name | (3E,5Z)-2-[(2S)-piperidin-2-yl]hepta-1,3,5-triene-4-sulfonamide |
|---|---|
| PubChem CID | 167033104 |
| Molecular Formula | C12H20N2O2S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | (3E,5Z)-2-[(2S)-piperidin-2-yl]hepta-1,3,5-triene-4-sulfonamide |
| SMILES | C=C(/C=C(\C=C/C)S(N)(=O)=O)[C@@H]1CCCCN1 |
| InChI | InChI=1S/C12H20N2O2S/c1-3-6-11(17(13,15)16)9-10(2)12-7-4-5-8-14-12/h3,6,9,12,14H,2,4-5,7-8H2,1H3,(H2,13,15,16)/b6-3-,11-9+/t12-/m0/s1 |
| InChIKey | NKPIOVURFWNGSB-XOKGXTSCSA-N |
| XLogP | 1.43 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|