C11H13N3S — CID 167033175
6-[(2S)-piperidin-2-yl]-[1,3]thiazolo[5,4-b]pyridine (PubChem CID 167033175) has the molecular formula C11H13N3S and a molecular weight of 219.31 g/mol. Its IUPAC name is 6-[(2S)-piperidin-2-yl]-[1,3]thiazolo[5,4-b]pyridine.
| Compound Name | 6-[(2S)-piperidin-2-yl]-[1,3]thiazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 167033175 |
| Molecular Formula | C11H13N3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 6-[(2S)-piperidin-2-yl]-[1,3]thiazolo[5,4-b]pyridine |
| SMILES | c1nc2cc([C@@H]3CCCCN3)cnc2s1 |
| InChI | InChI=1S/C11H13N3S/c1-2-4-12-9(3-1)8-5-10-11(13-6-8)15-7-14-10/h5-7,9,12H,1-4H2/t9-/m0/s1 |
| InChIKey | OOBTZBPATXDORL-VIFPVBQESA-N |
| XLogP | 2.51 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |