About 1,3-dimethyl-3,6-dihydro-2H-pyridin-4-ol
1,3-dimethyl-3,6-dihydro-2H-pyridin-4-ol (PubChem CID 167033333) has the molecular formula C7H13NO
and a molecular weight of 127.19 g/mol. Its IUPAC name is 1,3-dimethyl-3,6-dihydro-2H-pyridin-4-ol.
Molecular Properties
| Compound Name | 1,3-dimethyl-3,6-dihydro-2H-pyridin-4-ol |
| PubChem CID | 167033333 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | 1,3-dimethyl-3,6-dihydro-2H-pyridin-4-ol |
| SMILES | CC1CN(C)CC=C1O |
| InChI | InChI=1S/C7H13NO/c1-6-5-8(2)4-3-7(6)9/h3,6,9H,4-5H2,1-2H3 |
| InChIKey | BOGCQOFFSYPTQQ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,3-dimethyl-3,6-dihydro-2H-pyridin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-3,6-dihydro-2H-pyridin-4-ol?
The IUPAC name of 1,3-dimethyl-3,6-dihydro-2H-pyridin-4-ol (CID 167033333) is 1,3-dimethyl-3,6-dihydro-2H-pyridin-4-ol.
What is the SMILES notation for 1,3-dimethyl-3,6-dihydro-2H-pyridin-4-ol?
The canonical SMILES for 1,3-dimethyl-3,6-dihydro-2H-pyridin-4-ol is CC1CN(C)CC=C1O.
What is the InChIKey of 1,3-dimethyl-3,6-dihydro-2H-pyridin-4-ol?
The InChIKey is BOGCQOFFSYPTQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO/c1-6-5-8(2)4-3-7(6)9/h3,6,9H,4-5H2,1-2H3.
What are the key properties of 1,3-dimethyl-3,6-dihydro-2H-pyridin-4-ol?
1,3-dimethyl-3,6-dihydro-2H-pyridin-4-ol has a molecular weight of 127.19 g/mol, XLogP of 1.01, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-3,6-dihydro-2H-pyridin-4-ol is sourced from PubChem (CID 167033333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).