C13H17F4N — CID 167033485
(2S,5S)-2-[(3E,5E)-4,5-difluorohepta-1,3,5-trien-2-yl]-4,4-difluoro-5-methylpiperidine (PubChem CID 167033485) has the molecular formula C13H17F4N and a molecular weight of 263.28 g/mol. Its IUPAC name is (2S,5S)-2-[(3E,5E)-4,5-difluorohepta-1,3,5-trien-2-yl]-4,4-difluoro-5-methylpiperidine.
| Compound Name | (2S,5S)-2-[(3E,5E)-4,5-difluorohepta-1,3,5-trien-2-yl]-4,4-difluoro-5-methylpiperidine |
|---|---|
| PubChem CID | 167033485 |
| Molecular Formula | C13H17F4N |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | (2S,5S)-2-[(3E,5E)-4,5-difluorohepta-1,3,5-trien-2-yl]-4,4-difluoro-5-methylpiperidine |
| SMILES | C=C(/C=C(F)\C(F)=C/C)[C@@H]1CC(F)(F)[C@@H](C)CN1 |
| InChI | InChI=1S/C13H17F4N/c1-4-10(14)11(15)5-8(2)12-6-13(16,17)9(3)7-18-12/h4-5,9,12,18H,2,6-7H2,1,3H3/b10-4+,11-5+/t9-,12-/m0/s1 |
| InChIKey | AWAQAFRKOVFBPC-GSXPXCAKSA-N |
| XLogP | 3.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|