C15H19FN2O — CID 167034519
N-[(4-fluoro-7-methylcyclohepta-1,4,6-trien-1-yl)methyl]-N-[2-[(Z)-prop-1-enyl]iminoethyl]formamide (PubChem CID 167034519) has the molecular formula C15H19FN2O and a molecular weight of 262.33 g/mol. Its IUPAC name is N-[(4-fluoro-7-methylcyclohepta-1,4,6-trien-1-yl)methyl]-N-[2-[(Z)-prop-1-enyl]iminoethyl]formamide.
| Compound Name | N-[(4-fluoro-7-methylcyclohepta-1,4,6-trien-1-yl)methyl]-N-[2-[(Z)-prop-1-enyl]iminoethyl]formamide |
|---|---|
| PubChem CID | 167034519 |
| Molecular Formula | C15H19FN2O |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | N-[(4-fluoro-7-methylcyclohepta-1,4,6-trien-1-yl)methyl]-N-[2-[(Z)-prop-1-enyl]iminoethyl]formamide |
| SMILES | C/C=C\N=C\CN(C=O)CC1=CCC(F)=CC=C1C |
| InChI | InChI=1S/C15H19FN2O/c1-3-8-17-9-10-18(12-19)11-14-5-7-15(16)6-4-13(14)2/h3-6,8-9,12H,7,10-11H2,1-2H3/b8-3-,17-9+ |
| InChIKey | XYMASSYEBHMBKB-JFYVMSQGSA-N |
| XLogP | 3.18 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|