C13H23FN2O — CID 167034520
N-[(4Z,6R)-6-fluoro-2-methyl-4-(propylaminomethyl)hepta-1,4-dien-3-yl]formamide (PubChem CID 167034520) has the molecular formula C13H23FN2O and a molecular weight of 242.34 g/mol. Its IUPAC name is N-[(4Z,6R)-6-fluoro-2-methyl-4-(propylaminomethyl)hepta-1,4-dien-3-yl]formamide.
| Compound Name | N-[(4Z,6R)-6-fluoro-2-methyl-4-(propylaminomethyl)hepta-1,4-dien-3-yl]formamide |
|---|---|
| PubChem CID | 167034520 |
| Molecular Formula | C13H23FN2O |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | N-[(4Z,6R)-6-fluoro-2-methyl-4-(propylaminomethyl)hepta-1,4-dien-3-yl]formamide |
| SMILES | C=C(C)C(NC=O)/C(=C\[C@@H](C)F)CNCCC |
| InChI | InChI=1S/C13H23FN2O/c1-5-6-15-8-12(7-11(4)14)13(10(2)3)16-9-17/h7,9,11,13,15H,2,5-6,8H2,1,3-4H3,(H,16,17)/b12-7-/t11-,13?/m1/s1 |
| InChIKey | JMDLXJXIQDHLPO-DVJJTCDSSA-N |
| XLogP | 1.96 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|