C19H23FN2O3 — CID 167034713
methyl (4Z,6E)-7-[(5-fluoro-2-formamidophenyl)methyl-methylamino]nona-4,6,8-trienoate (PubChem CID 167034713) has the molecular formula C19H23FN2O3 and a molecular weight of 346.40 g/mol. Its IUPAC name is methyl (4Z,6E)-7-[(5-fluoro-2-formamidophenyl)methyl-methylamino]nona-4,6,8-trienoate.
| Compound Name | methyl (4Z,6E)-7-[(5-fluoro-2-formamidophenyl)methyl-methylamino]nona-4,6,8-trienoate |
|---|---|
| PubChem CID | 167034713 |
| Molecular Formula | C19H23FN2O3 |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | methyl (4Z,6E)-7-[(5-fluoro-2-formamidophenyl)methyl-methylamino]nona-4,6,8-trienoate |
| SMILES | C=C/C(=C\C=C/CCC(=O)OC)N(C)Cc1cc(F)ccc1NC=O |
| InChI | InChI=1S/C19H23FN2O3/c1-4-17(8-6-5-7-9-19(24)25-3)22(2)13-15-12-16(20)10-11-18(15)21-14-23/h4-6,8,10-12,14H,1,7,9,13H2,2-3H3,(H,21,23)/b6-5-,17-8+ |
| InChIKey | GPBRGNBYCIBFRC-KTCXWTAMSA-N |
| XLogP | 3.41 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|