C12H17N3 — CID 167035691
2,5-di(propan-2-yl)-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 167035691) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is 2,5-di(propan-2-yl)-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 2,5-di(propan-2-yl)-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 167035691 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 2,5-di(propan-2-yl)-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | CC(C)c1nc2cccc(C(C)C)n2n1 |
| InChI | InChI=1S/C12H17N3/c1-8(2)10-6-5-7-11-13-12(9(3)4)14-15(10)11/h5-9H,1-4H3 |
| InChIKey | BFMSBFKYPQLOFP-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |