C28H28F2N6O — CID 167037010
2-(5,5-difluoro-2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-7-methyl-4-(5-methyl-1H-indazol-4-yl)-5,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 167037010) has the molecular formula C28H28F2N6O and a molecular weight of 502.57 g/mol. Its IUPAC name is 2-(5,5-difluoro-2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-7-methyl-4-(5-methyl-1H-indazol-4-yl)-5,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | 2-(5,5-difluoro-2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-7-methyl-4-(5-methyl-1H-indazol-4-yl)-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 167037010 |
| Molecular Formula | C28H28F2N6O |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.23 |
| IUPAC Name | 2-(5,5-difluoro-2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-7-methyl-4-(5-methyl-1H-indazol-4-yl)-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | C=CC(=O)N1CC2(C1)CN(c1nc3c(c(-c4c(C)ccc5[nH]ncc45)c1C#N)CCC(C)C3)CC2(F)F |
| InChI | InChI=1S/C28H28F2N6O/c1-4-23(37)35-12-27(13-35)14-36(15-28(27,29)30)26-19(10-31)25(18-7-5-16(2)9-22(18)33-26)24-17(3)6-8-21-20(24)11-32-34-21/h4,6,8,11,16H,1,5,7,9,12-15H2,2-3H3,(H,32,34) |
| InChIKey | UFLLKZOHQYPZNU-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|