C30H29F3N6O — CID 167037020
(1R,9R)-10,10-dimethyl-4-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-6-[5-(trifluoromethyl)-1H-indazol-4-yl]-3-azatricyclo[7.1.1.02,7]undeca-2,4,6-triene-5-carbonitrile (PubChem CID 167037020) has the molecular formula C30H29F3N6O and a molecular weight of 546.60 g/mol. Its IUPAC name is (1R,9R)-10,10-dimethyl-4-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-6-[5-(trifluoromethyl)-1H-indazol-4-yl]-3-azatricyclo[7.1.1.02,7]undeca-2,4,6-triene-5-carbonitrile.
| Compound Name | (1R,9R)-10,10-dimethyl-4-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-6-[5-(trifluoromethyl)-1H-indazol-4-yl]-3-azatricyclo[7.1.1.02,7]undeca-2,4,6-triene-5-carbonitrile |
|---|---|
| PubChem CID | 167037020 |
| Molecular Formula | C30H29F3N6O |
| Molecular Weight | 546.60 g/mol |
| Exact Mass | 546.24 |
| IUPAC Name | (1R,9R)-10,10-dimethyl-4-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-6-[5-(trifluoromethyl)-1H-indazol-4-yl]-3-azatricyclo[7.1.1.02,7]undeca-2,4,6-triene-5-carbonitrile |
| SMILES | C=CC(=O)N1CC2(CCN(c3nc4c(c(-c5c(C(F)(F)F)ccc6[nH]ncc56)c3C#N)C[C@H]3C[C@@H]4C3(C)C)C2)C1 |
| InChI | InChI=1S/C30H29F3N6O/c1-4-23(40)39-14-29(15-39)7-8-38(13-29)27-18(11-34)24(17-9-16-10-21(26(17)36-27)28(16,2)3)25-19-12-35-37-22(19)6-5-20(25)30(31,32)33/h4-6,12,16,21H,1,7-10,13-15H2,2-3H3,(H,35,37)/t16-,21-/m0/s1 |
| InChIKey | UTZBBNLHKXVQIM-KKSFZXQISA-N |
| XLogP | 5.43 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.60 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|