C29H30F2N6O2 — CID 167037055
2-(5,5-difluoro-2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-4-(1,6-dimethylindazol-7-yl)-7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridine-3-carbonitrile (PubChem CID 167037055) has the molecular formula C29H30F2N6O2 and a molecular weight of 532.60 g/mol. Its IUPAC name is 2-(5,5-difluoro-2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-4-(1,6-dimethylindazol-7-yl)-7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridine-3-carbonitrile.
| Compound Name | 2-(5,5-difluoro-2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-4-(1,6-dimethylindazol-7-yl)-7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 167037055 |
| Molecular Formula | C29H30F2N6O2 |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.24 |
| IUPAC Name | 2-(5,5-difluoro-2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-4-(1,6-dimethylindazol-7-yl)-7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridine-3-carbonitrile |
| SMILES | C=CC(=O)N1CC2(C1)CN(c1nc3c(c(-c4c(C)ccc5cnn(C)c45)c1C#N)COC(C)(C)C3)CC2(F)F |
| InChI | InChI=1S/C29H30F2N6O2/c1-6-22(38)36-13-28(14-36)15-37(16-29(28,30)31)26-19(10-32)24(20-12-39-27(3,4)9-21(20)34-26)23-17(2)7-8-18-11-33-35(5)25(18)23/h6-8,11H,1,9,12-16H2,2-5H3 |
| InChIKey | KSTLOEBFKRZZIO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 87.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|