C30H30FN5O — CID 167037060
(1R,9R)-6-(6-fluoro-1H-indol-7-yl)-10,10-dimethyl-4-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-3-azatricyclo[7.1.1.02,7]undeca-2,4,6-triene-5-carbonitrile (PubChem CID 167037060) has the molecular formula C30H30FN5O and a molecular weight of 495.60 g/mol. Its IUPAC name is (1R,9R)-6-(6-fluoro-1H-indol-7-yl)-10,10-dimethyl-4-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-3-azatricyclo[7.1.1.02,7]undeca-2,4,6-triene-5-carbonitrile.
| Compound Name | (1R,9R)-6-(6-fluoro-1H-indol-7-yl)-10,10-dimethyl-4-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-3-azatricyclo[7.1.1.02,7]undeca-2,4,6-triene-5-carbonitrile |
|---|---|
| PubChem CID | 167037060 |
| Molecular Formula | C30H30FN5O |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | (1R,9R)-6-(6-fluoro-1H-indol-7-yl)-10,10-dimethyl-4-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-3-azatricyclo[7.1.1.02,7]undeca-2,4,6-triene-5-carbonitrile |
| SMILES | C=CC(=O)N1CC2(CCN(c3nc4c(c(-c5c(F)ccc6cc[nH]c56)c3C#N)C[C@H]3C[C@@H]4C3(C)C)C2)C1 |
| InChI | InChI=1S/C30H30FN5O/c1-4-23(37)36-15-30(16-36)8-10-35(14-30)28-20(13-32)24(25-22(31)6-5-17-7-9-33-26(17)25)19-11-18-12-21(27(19)34-28)29(18,2)3/h4-7,9,18,21,33H,1,8,10-12,14-16H2,2-3H3/t18-,21-/m0/s1 |
| InChIKey | QMKKMEPNMTYUBG-RXVVDRJESA-N |
| XLogP | 5.15 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|