C30H35N3O2 — CID 167037135
4-[3,7,7-trimethyl-2-(2-prop-2-enyl-2,7-diazaspiro[3.4]octan-7-yl)-5,8-dihydropyrano[4,3-b]pyridin-4-yl]naphthalen-2-ol (PubChem CID 167037135) has the molecular formula C30H35N3O2 and a molecular weight of 469.63 g/mol. Its IUPAC name is 4-[3,7,7-trimethyl-2-(2-prop-2-enyl-2,7-diazaspiro[3.4]octan-7-yl)-5,8-dihydropyrano[4,3-b]pyridin-4-yl]naphthalen-2-ol.
| Compound Name | 4-[3,7,7-trimethyl-2-(2-prop-2-enyl-2,7-diazaspiro[3.4]octan-7-yl)-5,8-dihydropyrano[4,3-b]pyridin-4-yl]naphthalen-2-ol |
|---|---|
| PubChem CID | 167037135 |
| Molecular Formula | C30H35N3O2 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.27 |
| IUPAC Name | 4-[3,7,7-trimethyl-2-(2-prop-2-enyl-2,7-diazaspiro[3.4]octan-7-yl)-5,8-dihydropyrano[4,3-b]pyridin-4-yl]naphthalen-2-ol |
| SMILES | C=CCN1CC2(CCN(c3nc4c(c(-c5cc(O)cc6ccccc56)c3C)COC(C)(C)C4)C2)C1 |
| InChI | InChI=1S/C30H35N3O2/c1-5-11-32-17-30(18-32)10-12-33(19-30)28-20(2)27(25-16-35-29(3,4)15-26(25)31-28)24-14-22(34)13-21-8-6-7-9-23(21)24/h5-9,13-14,34H,1,10-12,15-19H2,2-4H3 |
| InChIKey | YLUMLDIPVVKYFZ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 48.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|