C28H28ClFN4O2 — CID 167037139
(1R,9R)-6-(2-chloro-4-fluoro-5-hydroxyphenyl)-10,10-dimethyl-4-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-3-azatricyclo[7.1.1.02,7]undeca-2,4,6-triene-5-carbonitrile (PubChem CID 167037139) has the molecular formula C28H28ClFN4O2 and a molecular weight of 507.01 g/mol. Its IUPAC name is (1R,9R)-6-(2-chloro-4-fluoro-5-hydroxyphenyl)-10,10-dimethyl-4-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-3-azatricyclo[7.1.1.02,7]undeca-2,4,6-triene-5-carbonitrile.
| Compound Name | (1R,9R)-6-(2-chloro-4-fluoro-5-hydroxyphenyl)-10,10-dimethyl-4-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-3-azatricyclo[7.1.1.02,7]undeca-2,4,6-triene-5-carbonitrile |
|---|---|
| PubChem CID | 167037139 |
| Molecular Formula | C28H28ClFN4O2 |
| Molecular Weight | 507.01 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | (1R,9R)-6-(2-chloro-4-fluoro-5-hydroxyphenyl)-10,10-dimethyl-4-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-3-azatricyclo[7.1.1.02,7]undeca-2,4,6-triene-5-carbonitrile |
| SMILES | C=CC(=O)N1CC2(CCN(c3nc4c(c(-c5cc(O)c(F)cc5Cl)c3C#N)C[C@H]3C[C@@H]4C3(C)C)C2)C1 |
| InChI | InChI=1S/C28H28ClFN4O2/c1-4-23(36)34-13-28(14-34)5-6-33(12-28)26-18(11-31)24(16-9-22(35)21(30)10-20(16)29)17-7-15-8-19(25(17)32-26)27(15,2)3/h4,9-10,15,19,35H,1,5-8,12-14H2,2-3H3/t15-,19-/m0/s1 |
| InChIKey | CKBQJTRBJPFYMP-KXBFYZLASA-N |
| XLogP | 5.03 |
| TPSA | 80.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.01 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|