C28H32FN3O2 — CID 167037150
1-[7-[(1R,9R)-5-fluoro-6-(5-hydroxy-2-methylphenyl)-10,10-dimethyl-3-azatricyclo[7.1.1.02,7]undeca-2,4,6-trien-4-yl]-2,7-diazaspiro[3.4]octan-2-yl]prop-2-en-1-one (PubChem CID 167037150) has the molecular formula C28H32FN3O2 and a molecular weight of 461.58 g/mol. Its IUPAC name is 1-[7-[(1R,9R)-5-fluoro-6-(5-hydroxy-2-methylphenyl)-10,10-dimethyl-3-azatricyclo[7.1.1.02,7]undeca-2,4,6-trien-4-yl]-2,7-diazaspiro[3.4]octan-2-yl]prop-2-en-1-one.
| Compound Name | 1-[7-[(1R,9R)-5-fluoro-6-(5-hydroxy-2-methylphenyl)-10,10-dimethyl-3-azatricyclo[7.1.1.02,7]undeca-2,4,6-trien-4-yl]-2,7-diazaspiro[3.4]octan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 167037150 |
| Molecular Formula | C28H32FN3O2 |
| Molecular Weight | 461.58 g/mol |
| Exact Mass | 461.25 |
| IUPAC Name | 1-[7-[(1R,9R)-5-fluoro-6-(5-hydroxy-2-methylphenyl)-10,10-dimethyl-3-azatricyclo[7.1.1.02,7]undeca-2,4,6-trien-4-yl]-2,7-diazaspiro[3.4]octan-2-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC2(CCN(c3nc4c(c(-c5cc(O)ccc5C)c3F)C[C@H]3C[C@@H]4C3(C)C)C2)C1 |
| InChI | InChI=1S/C28H32FN3O2/c1-5-22(34)32-14-28(15-32)8-9-31(13-28)26-24(29)23(19-12-18(33)7-6-16(19)2)20-10-17-11-21(25(20)30-26)27(17,3)4/h5-7,12,17,21,33H,1,8-11,13-15H2,2-4H3/t17-,21-/m0/s1 |
| InChIKey | ARVPIFCKVDXHAZ-UWJYYQICSA-N |
| XLogP | 4.81 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.58 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|