C11H20O3 — CID 167037210
5-[(5-methyloxan-2-yl)methyl]-1,3-dioxane (PubChem CID 167037210) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is 5-[(5-methyloxan-2-yl)methyl]-1,3-dioxane.
| Compound Name | 5-[(5-methyloxan-2-yl)methyl]-1,3-dioxane |
|---|---|
| PubChem CID | 167037210 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | 5-[(5-methyloxan-2-yl)methyl]-1,3-dioxane |
| SMILES | CC1CCC(CC2COCOC2)OC1 |
| InChI | InChI=1S/C11H20O3/c1-9-2-3-11(14-5-9)4-10-6-12-8-13-7-10/h9-11H,2-8H2,1H3 |
| InChIKey | MXSGKKZSYZZBTJ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |