C11H13Cl2NO — CID 167037212
2,4-dichloro-3,7,7-trimethyl-5,8-dihydropyrano[4,3-b]pyridine (PubChem CID 167037212) has the molecular formula C11H13Cl2NO and a molecular weight of 246.14 g/mol. Its IUPAC name is 2,4-dichloro-3,7,7-trimethyl-5,8-dihydropyrano[4,3-b]pyridine.
| Compound Name | 2,4-dichloro-3,7,7-trimethyl-5,8-dihydropyrano[4,3-b]pyridine |
|---|---|
| PubChem CID | 167037212 |
| Molecular Formula | C11H13Cl2NO |
| Molecular Weight | 246.14 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 2,4-dichloro-3,7,7-trimethyl-5,8-dihydropyrano[4,3-b]pyridine |
| SMILES | Cc1c(Cl)nc2c(c1Cl)COC(C)(C)C2 |
| InChI | InChI=1S/C11H13Cl2NO/c1-6-9(12)7-5-15-11(2,3)4-8(7)14-10(6)13/h4-5H2,1-3H3 |
| InChIKey | DJOMEKPCYZZHOH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.14 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|