About 2-but-1-en-2-ylimino-N,3-dimethylbutanamide
2-but-1-en-2-ylimino-N,3-dimethylbutanamide (PubChem CID 167037268) has the molecular formula C10H18N2O
and a molecular weight of 182.27 g/mol. Its IUPAC name is 2-but-1-en-2-ylimino-N,3-dimethylbutanamide.
Molecular Properties
| Compound Name | 2-but-1-en-2-ylimino-N,3-dimethylbutanamide |
| PubChem CID | 167037268 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | 2-but-1-en-2-ylimino-N,3-dimethylbutanamide |
| SMILES | C=C(CC)/N=C(/C(=O)NC)C(C)C |
| InChI | InChI=1S/C10H18N2O/c1-6-8(4)12-9(7(2)3)10(13)11-5/h7H,4,6H2,1-3,5H3,(H,11,13)/b12-9+ |
| InChIKey | ZFJWNGKXMBIROC-FMIVXFBMSA-N |
| XLogP | 1.75 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-but-1-en-2-ylimino-N,3-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-but-1-en-2-ylimino-N,3-dimethylbutanamide?
The IUPAC name of 2-but-1-en-2-ylimino-N,3-dimethylbutanamide (CID 167037268) is 2-but-1-en-2-ylimino-N,3-dimethylbutanamide.
What is the SMILES notation for 2-but-1-en-2-ylimino-N,3-dimethylbutanamide?
The canonical SMILES for 2-but-1-en-2-ylimino-N,3-dimethylbutanamide is C=C(CC)/N=C(/C(=O)NC)C(C)C.
What is the InChIKey of 2-but-1-en-2-ylimino-N,3-dimethylbutanamide?
The InChIKey is ZFJWNGKXMBIROC-FMIVXFBMSA-N. The full InChI is InChI=1S/C10H18N2O/c1-6-8(4)12-9(7(2)3)10(13)11-5/h7H,4,6H2,1-3,5H3,(H,11,13)/b12-9+.
What are the key properties of 2-but-1-en-2-ylimino-N,3-dimethylbutanamide?
2-but-1-en-2-ylimino-N,3-dimethylbutanamide has a molecular weight of 182.27 g/mol, XLogP of 1.75, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-but-1-en-2-ylimino-N,3-dimethylbutanamide is sourced from PubChem (CID 167037268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).