C10H15NO — CID 167037368
(5S)-4-methoxy-5-methyl-4,5,6,7-tetrahydro-2H-isoindole (PubChem CID 167037368) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is (5S)-4-methoxy-5-methyl-4,5,6,7-tetrahydro-2H-isoindole.
| Compound Name | (5S)-4-methoxy-5-methyl-4,5,6,7-tetrahydro-2H-isoindole |
|---|---|
| PubChem CID | 167037368 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | (5S)-4-methoxy-5-methyl-4,5,6,7-tetrahydro-2H-isoindole |
| SMILES | COC1c2c[nH]cc2CC[C@@H]1C |
| InChI | InChI=1S/C10H15NO/c1-7-3-4-8-5-11-6-9(8)10(7)12-2/h5-7,10-11H,3-4H2,1-2H3/t7-,10?/m0/s1 |
| InChIKey | GCPVAYDSNKRGIL-BYDSUWOYSA-N |
| XLogP | 2.28 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |