C30H27FN4O2 — CID 167037486
(1aS,7bR)-4-(4-fluoro-3-hydroxynaphthalen-1-yl)-6-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-1a,2,3,7b-tetrahydro-1H-cyclopropa[h]quinoline-5-carbonitrile (PubChem CID 167037486) has the molecular formula C30H27FN4O2 and a molecular weight of 494.57 g/mol. Its IUPAC name is (1aS,7bR)-4-(4-fluoro-3-hydroxynaphthalen-1-yl)-6-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-1a,2,3,7b-tetrahydro-1H-cyclopropa[h]quinoline-5-carbonitrile.
| Compound Name | (1aS,7bR)-4-(4-fluoro-3-hydroxynaphthalen-1-yl)-6-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-1a,2,3,7b-tetrahydro-1H-cyclopropa[h]quinoline-5-carbonitrile |
|---|---|
| PubChem CID | 167037486 |
| Molecular Formula | C30H27FN4O2 |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | (1aS,7bR)-4-(4-fluoro-3-hydroxynaphthalen-1-yl)-6-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-1a,2,3,7b-tetrahydro-1H-cyclopropa[h]quinoline-5-carbonitrile |
| SMILES | C=CC(=O)N1CC2(CCN(c3nc4c(c(-c5cc(O)c(F)c6ccccc56)c3C#N)CC[C@H]3C[C@@H]43)C2)C1 |
| InChI | InChI=1S/C30H27FN4O2/c1-2-25(37)35-15-30(16-35)9-10-34(14-30)29-23(13-32)26(20-8-7-17-11-21(17)28(20)33-29)22-12-24(36)27(31)19-6-4-3-5-18(19)22/h2-6,12,17,21,36H,1,7-11,14-16H2/t17-,21+/m0/s1 |
| InChIKey | JUNMFHYKVNHOJV-LAUBAEHRSA-N |
| XLogP | 4.89 |
| TPSA | 80.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|