About 7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridine
7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridine (PubChem CID 167037500) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is 7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridine.
Molecular Properties
| Compound Name | 7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridine |
| PubChem CID | 167037500 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridine |
| SMILES | CC1(C)Cc2ncccc2CO1 |
| InChI | InChI=1S/C10H13NO/c1-10(2)6-9-8(7-12-10)4-3-5-11-9/h3-5H,6-7H2,1-2H3 |
| InChIKey | NPHLWDZJOJWBDW-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridine?
The IUPAC name of 7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridine (CID 167037500) is 7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridine.
What is the SMILES notation for 7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridine?
The canonical SMILES for 7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridine is CC1(C)Cc2ncccc2CO1.
What is the InChIKey of 7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridine?
The InChIKey is NPHLWDZJOJWBDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO/c1-10(2)6-9-8(7-12-10)4-3-5-11-9/h3-5H,6-7H2,1-2H3.
What are the key properties of 7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridine?
7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridine has a molecular weight of 163.22 g/mol, XLogP of 1.93, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridine is sourced from PubChem (CID 167037500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).