C29H33F2N5O2 — CID 167037508
1-[7-[3-(difluoromethyl)-4-(1,6-dimethylindazol-7-yl)-7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridin-2-yl]-2,7-diazaspiro[3.4]octan-2-yl]prop-2-en-1-one (PubChem CID 167037508) has the molecular formula C29H33F2N5O2 and a molecular weight of 521.61 g/mol. Its IUPAC name is 1-[7-[3-(difluoromethyl)-4-(1,6-dimethylindazol-7-yl)-7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridin-2-yl]-2,7-diazaspiro[3.4]octan-2-yl]prop-2-en-1-one.
| Compound Name | 1-[7-[3-(difluoromethyl)-4-(1,6-dimethylindazol-7-yl)-7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridin-2-yl]-2,7-diazaspiro[3.4]octan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 167037508 |
| Molecular Formula | C29H33F2N5O2 |
| Molecular Weight | 521.61 g/mol |
| Exact Mass | 521.26 |
| IUPAC Name | 1-[7-[3-(difluoromethyl)-4-(1,6-dimethylindazol-7-yl)-7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridin-2-yl]-2,7-diazaspiro[3.4]octan-2-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC2(CCN(c3nc4c(c(-c5c(C)ccc6cnn(C)c56)c3C(F)F)COC(C)(C)C4)C2)C1 |
| InChI | InChI=1S/C29H33F2N5O2/c1-6-21(37)36-15-29(16-36)9-10-35(14-29)27-24(26(30)31)23(19-13-38-28(3,4)11-20(19)33-27)22-17(2)7-8-18-12-32-34(5)25(18)22/h6-8,12,26H,1,9-11,13-16H2,2-5H3 |
| InChIKey | PXMVCNDFJKMEOL-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.61 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|