C31H33F3N4O3 — CID 167037538
1-[7-[4-(6-hydroxynaphthalen-1-yl)-3-methyl-7-(3,3,3-trifluoro-2-hydroxypropyl)-6,8-dihydro-5H-1,7-naphthyridin-2-yl]-2,7-diazaspiro[3.4]octan-2-yl]prop-2-en-1-one (PubChem CID 167037538) has the molecular formula C31H33F3N4O3 and a molecular weight of 566.62 g/mol. Its IUPAC name is 1-[7-[4-(6-hydroxynaphthalen-1-yl)-3-methyl-7-(3,3,3-trifluoro-2-hydroxypropyl)-6,8-dihydro-5H-1,7-naphthyridin-2-yl]-2,7-diazaspiro[3.4]octan-2-yl]prop-2-en-1-one.
| Compound Name | 1-[7-[4-(6-hydroxynaphthalen-1-yl)-3-methyl-7-(3,3,3-trifluoro-2-hydroxypropyl)-6,8-dihydro-5H-1,7-naphthyridin-2-yl]-2,7-diazaspiro[3.4]octan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 167037538 |
| Molecular Formula | C31H33F3N4O3 |
| Molecular Weight | 566.62 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | 1-[7-[4-(6-hydroxynaphthalen-1-yl)-3-methyl-7-(3,3,3-trifluoro-2-hydroxypropyl)-6,8-dihydro-5H-1,7-naphthyridin-2-yl]-2,7-diazaspiro[3.4]octan-2-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC2(CCN(c3nc4c(c(-c5cccc6cc(O)ccc56)c3C)CCN(CC(O)C(F)(F)F)C4)C2)C1 |
| InChI | InChI=1S/C31H33F3N4O3/c1-3-27(41)38-17-30(18-38)10-12-37(16-30)29-19(2)28(23-6-4-5-20-13-21(39)7-8-22(20)23)24-9-11-36(14-25(24)35-29)15-26(40)31(32,33)34/h3-8,13,26,39-40H,1,9-12,14-18H2,2H3 |
| InChIKey | ZVIVCXPBDDIRCK-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 80.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.62 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|