C27H31F2N3O2 — CID 167037700
1-[7-[4-(2,3-difluoro-5-hydroxyphenyl)-3,7,7-trimethyl-6,8-dihydro-5H-quinolin-2-yl]-2,7-diazaspiro[3.4]octan-2-yl]prop-2-en-1-one (PubChem CID 167037700) has the molecular formula C27H31F2N3O2 and a molecular weight of 467.56 g/mol. Its IUPAC name is 1-[7-[4-(2,3-difluoro-5-hydroxyphenyl)-3,7,7-trimethyl-6,8-dihydro-5H-quinolin-2-yl]-2,7-diazaspiro[3.4]octan-2-yl]prop-2-en-1-one.
| Compound Name | 1-[7-[4-(2,3-difluoro-5-hydroxyphenyl)-3,7,7-trimethyl-6,8-dihydro-5H-quinolin-2-yl]-2,7-diazaspiro[3.4]octan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 167037700 |
| Molecular Formula | C27H31F2N3O2 |
| Molecular Weight | 467.56 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | 1-[7-[4-(2,3-difluoro-5-hydroxyphenyl)-3,7,7-trimethyl-6,8-dihydro-5H-quinolin-2-yl]-2,7-diazaspiro[3.4]octan-2-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC2(CCN(c3nc4c(c(-c5cc(O)cc(F)c5F)c3C)CCC(C)(C)C4)C2)C1 |
| InChI | InChI=1S/C27H31F2N3O2/c1-5-22(34)32-14-27(15-32)8-9-31(13-27)25-16(2)23(19-10-17(33)11-20(28)24(19)29)18-6-7-26(3,4)12-21(18)30-25/h5,10-11,33H,1,6-9,12-15H2,2-4H3 |
| InChIKey | HGRKFWCRYXVVHI-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.56 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|