C30H31FN6O — CID 167037709
(1R,9R)-6-(7-fluoro-5-methyl-1H-indazol-4-yl)-10,10-dimethyl-4-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-3-azatricyclo[7.1.1.02,7]undeca-2,4,6-triene-5-carbonitrile (PubChem CID 167037709) has the molecular formula C30H31FN6O and a molecular weight of 510.62 g/mol. Its IUPAC name is (1R,9R)-6-(7-fluoro-5-methyl-1H-indazol-4-yl)-10,10-dimethyl-4-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-3-azatricyclo[7.1.1.02,7]undeca-2,4,6-triene-5-carbonitrile.
| Compound Name | (1R,9R)-6-(7-fluoro-5-methyl-1H-indazol-4-yl)-10,10-dimethyl-4-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-3-azatricyclo[7.1.1.02,7]undeca-2,4,6-triene-5-carbonitrile |
|---|---|
| PubChem CID | 167037709 |
| Molecular Formula | C30H31FN6O |
| Molecular Weight | 510.62 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | (1R,9R)-6-(7-fluoro-5-methyl-1H-indazol-4-yl)-10,10-dimethyl-4-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)-3-azatricyclo[7.1.1.02,7]undeca-2,4,6-triene-5-carbonitrile |
| SMILES | C=CC(=O)N1CC2(CCN(c3nc4c(c(-c5c(C)cc(F)c6[nH]ncc56)c3C#N)C[C@H]3C[C@@H]4C3(C)C)C2)C1 |
| InChI | InChI=1S/C30H31FN6O/c1-5-23(38)37-14-30(15-37)6-7-36(13-30)28-19(11-32)25(18-9-17-10-21(26(18)34-28)29(17,3)4)24-16(2)8-22(31)27-20(24)12-33-35-27/h5,8,12,17,21H,1,6-7,9-10,13-15H2,2-4H3,(H,33,35)/t17-,21-/m0/s1 |
| InChIKey | OFXOUBPSHGYGGC-UWJYYQICSA-N |
| XLogP | 4.85 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.62 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|