C19H31N — CID 167037882
5-(5-ethyl-2,3,3-trimethylheptan-2-yl)-6-methylidenecyclohexa-2,4-dien-1-imine (PubChem CID 167037882) has the molecular formula C19H31N and a molecular weight of 273.46 g/mol. Its IUPAC name is 5-(5-ethyl-2,3,3-trimethylheptan-2-yl)-6-methylidenecyclohexa-2,4-dien-1-imine.
| Compound Name | 5-(5-ethyl-2,3,3-trimethylheptan-2-yl)-6-methylidenecyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 167037882 |
| Molecular Formula | C19H31N |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.25 |
| IUPAC Name | 5-(5-ethyl-2,3,3-trimethylheptan-2-yl)-6-methylidenecyclohexa-2,4-dien-1-imine |
| SMILES | [H]/N=C1\C=CC=C(C(C)(C)C(C)(C)CC(CC)CC)C1=C |
| InChI | InChI=1S/C19H31N/c1-8-15(9-2)13-18(4,5)19(6,7)16-11-10-12-17(20)14(16)3/h10-12,15,20H,3,8-9,13H2,1-2,4-7H3/b20-17+ |
| InChIKey | LVDLWMSUGZGWDE-LVZFUZTISA-N |
| XLogP | 5.94 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|