About 7-tert-butyl-4-ethyl-5-(1-methylcyclopentyl)-2,3-dihydroquinoline
7-tert-butyl-4-ethyl-5-(1-methylcyclopentyl)-2,3-dihydroquinoline (PubChem CID 167038022) has the molecular formula C21H31N
and a molecular weight of 297.49 g/mol. Its IUPAC name is 7-tert-butyl-4-ethyl-5-(1-methylcyclopentyl)-2,3-dihydroquinoline.
Molecular Properties
| Compound Name | 7-tert-butyl-4-ethyl-5-(1-methylcyclopentyl)-2,3-dihydroquinoline |
| PubChem CID | 167038022 |
| Molecular Formula | C21H31N |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.25 |
| IUPAC Name | 7-tert-butyl-4-ethyl-5-(1-methylcyclopentyl)-2,3-dihydroquinoline |
| SMILES | CCC1=c2c(C3(C)CCCC3)cc(C(C)(C)C)cc2=NCC1 |
| InChI | InChI=1S/C21H31N/c1-6-15-9-12-22-18-14-16(20(2,3)4)13-17(19(15)18)21(5)10-7-8-11-21/h13-14H,6-12H2,1-5H3 |
| InChIKey | ZGVOKZIFRXENFM-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-tert-butyl-4-ethyl-5-(1-methylcyclopentyl)-2,3-dihydroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-tert-butyl-4-ethyl-5-(1-methylcyclopentyl)-2,3-dihydroquinoline?
The IUPAC name of 7-tert-butyl-4-ethyl-5-(1-methylcyclopentyl)-2,3-dihydroquinoline (CID 167038022) is 7-tert-butyl-4-ethyl-5-(1-methylcyclopentyl)-2,3-dihydroquinoline.
What is the SMILES notation for 7-tert-butyl-4-ethyl-5-(1-methylcyclopentyl)-2,3-dihydroquinoline?
The canonical SMILES for 7-tert-butyl-4-ethyl-5-(1-methylcyclopentyl)-2,3-dihydroquinoline is CCC1=c2c(C3(C)CCCC3)cc(C(C)(C)C)cc2=NCC1.
What is the InChIKey of 7-tert-butyl-4-ethyl-5-(1-methylcyclopentyl)-2,3-dihydroquinoline?
The InChIKey is ZGVOKZIFRXENFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H31N/c1-6-15-9-12-22-18-14-16(20(2,3)4)13-17(19(15)18)21(5)10-7-8-11-21/h13-14H,6-12H2,1-5H3.
What are the key properties of 7-tert-butyl-4-ethyl-5-(1-methylcyclopentyl)-2,3-dihydroquinoline?
7-tert-butyl-4-ethyl-5-(1-methylcyclopentyl)-2,3-dihydroquinoline has a molecular weight of 297.49 g/mol, XLogP of 4.40, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-tert-butyl-4-ethyl-5-(1-methylcyclopentyl)-2,3-dihydroquinoline is sourced from PubChem (CID 167038022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).