C15H19N3 — CID 167038349
2-cyclohexa-1,3-dien-1-yl-6-cyclohexa-2,4-dien-1-yl-1,2,3,4-tetrahydro-1,3,5-triazine (PubChem CID 167038349) has the molecular formula C15H19N3 and a molecular weight of 241.34 g/mol. Its IUPAC name is 2-cyclohexa-1,3-dien-1-yl-6-cyclohexa-2,4-dien-1-yl-1,2,3,4-tetrahydro-1,3,5-triazine.
| Compound Name | 2-cyclohexa-1,3-dien-1-yl-6-cyclohexa-2,4-dien-1-yl-1,2,3,4-tetrahydro-1,3,5-triazine |
|---|---|
| PubChem CID | 167038349 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 2-cyclohexa-1,3-dien-1-yl-6-cyclohexa-2,4-dien-1-yl-1,2,3,4-tetrahydro-1,3,5-triazine |
| SMILES | C1=CCCC(C2NCN=C(C3C=CC=CC3)N2)=C1 |
| InChI | InChI=1S/C15H19N3/c1-3-7-12(8-4-1)14-16-11-17-15(18-14)13-9-5-2-6-10-13/h1-5,7,9,12,15,17H,6,8,10-11H2,(H,16,18) |
| InChIKey | LWHBHXMQNBHQFH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |