About 6-bromo-3-(4-chlorophenyl)-1,2-dihydronaphthalene
6-bromo-3-(4-chlorophenyl)-1,2-dihydronaphthalene (PubChem CID 167038414) has the molecular formula C16H12BrCl
and a molecular weight of 319.63 g/mol. Its IUPAC name is 6-bromo-3-(4-chlorophenyl)-1,2-dihydronaphthalene.
Molecular Properties
| Compound Name | 6-bromo-3-(4-chlorophenyl)-1,2-dihydronaphthalene |
| PubChem CID | 167038414 |
| Molecular Formula | C16H12BrCl |
| Molecular Weight | 319.63 g/mol |
| Exact Mass | 317.98 |
| IUPAC Name | 6-bromo-3-(4-chlorophenyl)-1,2-dihydronaphthalene |
| SMILES | Clc1ccc(C2=Cc3cc(Br)ccc3CC2)cc1 |
| InChI | InChI=1S/C16H12BrCl/c17-15-6-3-12-1-2-13(9-14(12)10-15)11-4-7-16(18)8-5-11/h3-10H,1-2H2 |
| InChIKey | SWDXPFJQPFJHCK-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 319.63 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-3-(4-chlorophenyl)-1,2-dihydronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-3-(4-chlorophenyl)-1,2-dihydronaphthalene?
The IUPAC name of 6-bromo-3-(4-chlorophenyl)-1,2-dihydronaphthalene (CID 167038414) is 6-bromo-3-(4-chlorophenyl)-1,2-dihydronaphthalene.
What is the SMILES notation for 6-bromo-3-(4-chlorophenyl)-1,2-dihydronaphthalene?
The canonical SMILES for 6-bromo-3-(4-chlorophenyl)-1,2-dihydronaphthalene is Clc1ccc(C2=Cc3cc(Br)ccc3CC2)cc1.
What is the InChIKey of 6-bromo-3-(4-chlorophenyl)-1,2-dihydronaphthalene?
The InChIKey is SWDXPFJQPFJHCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12BrCl/c17-15-6-3-12-1-2-13(9-14(12)10-15)11-4-7-16(18)8-5-11/h3-10H,1-2H2.
What are the key properties of 6-bromo-3-(4-chlorophenyl)-1,2-dihydronaphthalene?
6-bromo-3-(4-chlorophenyl)-1,2-dihydronaphthalene has a molecular weight of 319.63 g/mol, XLogP of 5.59, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-3-(4-chlorophenyl)-1,2-dihydronaphthalene is sourced from PubChem (CID 167038414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).