C34H64F2N2 — CID 167038708
(E)-19,19-difluoro-6-heptyl-4-imino-N,N-dimethyl-14-methylidenetetracos-17-en-1-amine (PubChem CID 167038708) has the molecular formula C34H64F2N2 and a molecular weight of 538.90 g/mol. Its IUPAC name is (E)-19,19-difluoro-6-heptyl-4-imino-N,N-dimethyl-14-methylidenetetracos-17-en-1-amine.
| Compound Name | (E)-19,19-difluoro-6-heptyl-4-imino-N,N-dimethyl-14-methylidenetetracos-17-en-1-amine |
|---|---|
| PubChem CID | 167038708 |
| Molecular Formula | C34H64F2N2 |
| Molecular Weight | 538.90 g/mol |
| Exact Mass | 538.50 |
| IUPAC Name | (E)-19,19-difluoro-6-heptyl-4-imino-N,N-dimethyl-14-methylidenetetracos-17-en-1-amine |
| SMILES | [H]/N=C(\CCCN(C)C)CC(CCCCCCC)CCCCCCCC(=C)CC/C=C/C(F)(F)CCCCC |
| InChI | InChI=1S/C34H64F2N2/c1-6-8-10-12-16-24-32(30-33(37)26-21-29-38(4)5)25-17-14-11-13-15-22-31(3)23-18-20-28-34(35,36)27-19-9-7-2/h20,28,32,37H,3,6-19,21-27,29-30H2,1-2,4-5H3/b28-20+,37-33+ |
| InChIKey | AVSZBPJGBWAGSR-JZDJPGNUSA-N |
| XLogP | 11.55 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.90 |
| LogP ≤ 5 | 11.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|