C27H33N7S — CID 167038841
(1S)-1'-[8-[(1Z,3E)-1-amino-2-methyl-1-(methylideneamino)penta-1,3-dien-3-yl]sulfanyl-7-methylimidazo[1,2-c]pyrimidin-5-yl]spiro[1,3-dihydroindene-2,4'-piperidine]-1-amine (PubChem CID 167038841) has the molecular formula C27H33N7S and a molecular weight of 487.68 g/mol. Its IUPAC name is (1S)-1'-[8-[(1Z,3E)-1-amino-2-methyl-1-(methylideneamino)penta-1,3-dien-3-yl]sulfanyl-7-methylimidazo[1,2-c]pyrimidin-5-yl]spiro[1,3-dihydroindene-2,4'-piperidine]-1-amine.
| Compound Name | (1S)-1'-[8-[(1Z,3E)-1-amino-2-methyl-1-(methylideneamino)penta-1,3-dien-3-yl]sulfanyl-7-methylimidazo[1,2-c]pyrimidin-5-yl]spiro[1,3-dihydroindene-2,4'-piperidine]-1-amine |
|---|---|
| PubChem CID | 167038841 |
| Molecular Formula | C27H33N7S |
| Molecular Weight | 487.68 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | (1S)-1'-[8-[(1Z,3E)-1-amino-2-methyl-1-(methylideneamino)penta-1,3-dien-3-yl]sulfanyl-7-methylimidazo[1,2-c]pyrimidin-5-yl]spiro[1,3-dihydroindene-2,4'-piperidine]-1-amine |
| SMILES | C=N/C(N)=C(C)\C(=C/C)Sc1c(C)nc(N2CCC3(CC2)Cc2ccccc2[C@H]3N)n2ccnc12 |
| InChI | InChI=1S/C27H33N7S/c1-5-21(17(2)24(29)30-4)35-22-18(3)32-26(34-15-12-31-25(22)34)33-13-10-27(11-14-33)16-19-8-6-7-9-20(19)23(27)28/h5-9,12,15,23H,4,10-11,13-14,16,28-29H2,1-3H3/b21-5+,24-17-/t23-/m1/s1 |
| InChIKey | PFJCOGRJDGXIKX-NKIKZWDZSA-N |
| XLogP | 4.77 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.68 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|