C28H27ClN8O5 — CID 167039047
13-[4-(5-chloro-1-methylindazol-7-yl)-6-oxopyrimidin-1-yl]-9-methyl-3-(trihydroxymethyl)-3,4,7,15-tetrazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-8-one (PubChem CID 167039047) has the molecular formula C28H27ClN8O5 and a molecular weight of 591.03 g/mol. Its IUPAC name is 13-[4-(5-chloro-1-methylindazol-7-yl)-6-oxopyrimidin-1-yl]-9-methyl-3-(trihydroxymethyl)-3,4,7,15-tetrazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-8-one.
| Compound Name | 13-[4-(5-chloro-1-methylindazol-7-yl)-6-oxopyrimidin-1-yl]-9-methyl-3-(trihydroxymethyl)-3,4,7,15-tetrazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-8-one |
|---|---|
| PubChem CID | 167039047 |
| Molecular Formula | C28H27ClN8O5 |
| Molecular Weight | 591.03 g/mol |
| Exact Mass | 590.18 |
| IUPAC Name | 13-[4-(5-chloro-1-methylindazol-7-yl)-6-oxopyrimidin-1-yl]-9-methyl-3-(trihydroxymethyl)-3,4,7,15-tetrazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-8-one |
| SMILES | CC1CCCC(n2cnc(-c3cc(Cl)cc4cnn(C)c34)cc2=O)c2cc(ccn2)-c2c(cnn2C(O)(O)O)NC1=O |
| InChI | InChI=1S/C28H27ClN8O5/c1-15-4-3-5-23(21-9-16(6-7-30-21)26-22(34-27(15)39)13-33-37(26)28(40,41)42)36-14-31-20(11-24(36)38)19-10-18(29)8-17-12-32-35(2)25(17)19/h6-15,23,40-42H,3-5H2,1-2H3,(H,34,39) |
| InChIKey | BMSDRYPHVMGRKO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 173.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.03 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|