C29H40N2O3 — CID 167039085
2-[[7-[4-(2-butoxyethoxy)phenyl]-4-methyl-2,3-dihydro-1-benzazepin-1-yl]methyl]-4-methylmorpholine (PubChem CID 167039085) has the molecular formula C29H40N2O3 and a molecular weight of 464.65 g/mol. Its IUPAC name is 2-[[7-[4-(2-butoxyethoxy)phenyl]-4-methyl-2,3-dihydro-1-benzazepin-1-yl]methyl]-4-methylmorpholine.
| Compound Name | 2-[[7-[4-(2-butoxyethoxy)phenyl]-4-methyl-2,3-dihydro-1-benzazepin-1-yl]methyl]-4-methylmorpholine |
|---|---|
| PubChem CID | 167039085 |
| Molecular Formula | C29H40N2O3 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.30 |
| IUPAC Name | 2-[[7-[4-(2-butoxyethoxy)phenyl]-4-methyl-2,3-dihydro-1-benzazepin-1-yl]methyl]-4-methylmorpholine |
| SMILES | CCCCOCCOc1ccc(-c2ccc3c(c2)C=C(C)CCN3CC2CN(C)CCO2)cc1 |
| InChI | InChI=1S/C29H40N2O3/c1-4-5-15-32-17-18-34-27-9-6-24(7-10-27)25-8-11-29-26(20-25)19-23(2)12-13-31(29)22-28-21-30(3)14-16-33-28/h6-11,19-20,28H,4-5,12-18,21-22H2,1-3H3 |
| InChIKey | NWDPYLVUISNCHB-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|