About 1-[4-(1-aminoethyl)-3,6-dihydro-2H-pyridin-1-yl]ethanethiol
1-[4-(1-aminoethyl)-3,6-dihydro-2H-pyridin-1-yl]ethanethiol (PubChem CID 167040100) has the molecular formula C9H18N2S
and a molecular weight of 186.32 g/mol. Its IUPAC name is 1-[4-(1-aminoethyl)-3,6-dihydro-2H-pyridin-1-yl]ethanethiol.
Molecular Properties
| Compound Name | 1-[4-(1-aminoethyl)-3,6-dihydro-2H-pyridin-1-yl]ethanethiol |
| PubChem CID | 167040100 |
| Molecular Formula | C9H18N2S |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 1-[4-(1-aminoethyl)-3,6-dihydro-2H-pyridin-1-yl]ethanethiol |
| SMILES | CC(N)C1=CCN(C(C)S)CC1 |
| InChI | InChI=1S/C9H18N2S/c1-7(10)9-3-5-11(6-4-9)8(2)12/h3,7-8,12H,4-6,10H2,1-2H3 |
| InChIKey | VBLCUCKPMDAIEP-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(1-aminoethyl)-3,6-dihydro-2H-pyridin-1-yl]ethanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(1-aminoethyl)-3,6-dihydro-2H-pyridin-1-yl]ethanethiol?
The IUPAC name of 1-[4-(1-aminoethyl)-3,6-dihydro-2H-pyridin-1-yl]ethanethiol (CID 167040100) is 1-[4-(1-aminoethyl)-3,6-dihydro-2H-pyridin-1-yl]ethanethiol.
What is the SMILES notation for 1-[4-(1-aminoethyl)-3,6-dihydro-2H-pyridin-1-yl]ethanethiol?
The canonical SMILES for 1-[4-(1-aminoethyl)-3,6-dihydro-2H-pyridin-1-yl]ethanethiol is CC(N)C1=CCN(C(C)S)CC1.
What is the InChIKey of 1-[4-(1-aminoethyl)-3,6-dihydro-2H-pyridin-1-yl]ethanethiol?
The InChIKey is VBLCUCKPMDAIEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2S/c1-7(10)9-3-5-11(6-4-9)8(2)12/h3,7-8,12H,4-6,10H2,1-2H3.
What are the key properties of 1-[4-(1-aminoethyl)-3,6-dihydro-2H-pyridin-1-yl]ethanethiol?
1-[4-(1-aminoethyl)-3,6-dihydro-2H-pyridin-1-yl]ethanethiol has a molecular weight of 186.32 g/mol, XLogP of 1.24, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(1-aminoethyl)-3,6-dihydro-2H-pyridin-1-yl]ethanethiol is sourced from PubChem (CID 167040100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).