C18H33F3N6O — CID 167040167
2-[[2-(2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,3-diazinan-4-yl]amino]-2-methyl-N-(2,2,2-trifluoroethyl)butanamide (PubChem CID 167040167) has the molecular formula C18H33F3N6O and a molecular weight of 406.50 g/mol. Its IUPAC name is 2-[[2-(2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,3-diazinan-4-yl]amino]-2-methyl-N-(2,2,2-trifluoroethyl)butanamide.
| Compound Name | 2-[[2-(2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,3-diazinan-4-yl]amino]-2-methyl-N-(2,2,2-trifluoroethyl)butanamide |
|---|---|
| PubChem CID | 167040167 |
| Molecular Formula | C18H33F3N6O |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | 2-[[2-(2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,3-diazinan-4-yl]amino]-2-methyl-N-(2,2,2-trifluoroethyl)butanamide |
| SMILES | CCC(C)(NC1CCNC(C2CNC3NCCCC32)N1)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C18H33F3N6O/c1-3-17(2,16(28)25-10-18(19,20)21)27-13-6-8-23-15(26-13)12-9-24-14-11(12)5-4-7-22-14/h11-15,22-24,26-27H,3-10H2,1-2H3,(H,25,28) |
| InChIKey | GEURTVADSGMKQL-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |